Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PKI-587 is a highly potent PI3K/mTOR kinase inhibitor that inhibits PI3K-α,β,γ, δ isoforms and mTOR with IC50 of 0.4, 6.0, 5.4, 6.0 and 1.6 nM respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11079 |
|---|---|
| Formula | C32H41N9O4 |
| Molecular Weight | 615.7 |
| CAS Number | 1197160-78-3 |
| SMILES | CN(C)C1CCN(CC1)C(=O)C2=CC=C(C=C2)NC(=O)NC3=CC=C(C=C3)C4=NC(=NC(=N4)N5CCOCC5)N6CCOCC6 |
| Synonyms | PKI587, Gedatolisib |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 2 mg/mL (3.24 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.24 mL | 81.21 mL | 162.42 mL |
| 0.5 mM | 3.25 mL | 16.24 mL | 32.48 mL |
| 1 mM | 1.62 mL | 8.12 mL | 16.24 mL |
| 5 mM | 0.32 mL | 1.62 mL | 3.25 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
