Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Polymyxin B Sulfate is a cationic surfactant antibiotic agent. A mixture of polymyxins B1 and B2, increases the permeability of the cell membrane. |
|---|
| Catalog Num | A10742 |
|---|---|
| Formula | C56H100N16O17S |
| Molecular Weight | 1301.56 |
| CAS Number | 1405-20-5 |
| SMILES | CCC(C)CCCCC(=O)NC(CCN)C(=O)NC(C(C)O)C(=O)NC(CCN)C(=O)NC1CCNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CCN)CC2=CC=CC=C2)CC(C)C)CCN)CCN)C(C)O.OS(=O)(=O)O |
| Synonyms | KS-1428 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 86 mg/mL (66.07 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 7.68 mL | 38.42 mL | 76.83 mL |
| 0.5 mM | 1.54 mL | 7.68 mL | 15.37 mL |
| 1 mM | 0.77 mL | 3.84 mL | 7.68 mL |
| 5 mM | 0.15 mL | 0.77 mL | 1.54 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
