Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pomalidomide is a derivative of thalidomide and acts as an immunomodulator. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10743 |
|---|---|
| Formula | C13H11N3O4 |
| Molecular Weight | 273.2 |
| CAS Number | 19171-19-8 |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)N |
| Synonyms | Actimid |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 50 mg/mL (182.98 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+2% Tween 80+ddH2O | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.6 mL | 183.02 mL | 366.03 mL |
| 0.5 mM | 7.32 mL | 36.6 mL | 73.21 mL |
| 1 mM | 3.66 mL | 18.3 mL | 36.6 mL |
| 5 mM | 0.73 mL | 3.66 mL | 7.32 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
