Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PSI-7977 is a phosphoramidate prodrug of PSI-7851, a nucleoside analog that, when phosphorylated, inhibits the RNA-dependent RNA polymerase of hepatitis C virus (EC50 = 92 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11529 |
|---|---|
| Formula | C22H29FN3O9P |
| Molecular Weight | 529.45 |
| CAS Number | 1190307-88-0 |
| SMILES | C[C@@H](C(=O)OC(C)C)N[P@](=O)(OC[C@@H]1[C@H]([C@@]([C@@H](O1)N2C=CC(=O)NC2=O)(C)F)O)OC3=CC=CC=C3 |
| Synonyms | GI-7977 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 86 mg/mL (162.43 mM) | |
| Water | Warmed: 9 mg/mL (16.99 mM) | ||
| Ethanol | 86 mg/mL (162.43 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.89 mL | 94.44 mL | 188.88 mL |
| 0.5 mM | 3.78 mL | 18.89 mL | 37.78 mL |
| 1 mM | 1.89 mL | 9.44 mL | 18.89 mL |
| 5 mM | 0.38 mL | 1.89 mL | 3.78 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
