Istaroxime hydrochloride is a positive inotropic agent that mediates its action through inhibition of sodium/potassium adenosine triphosphatase (Na+/K+ ATPase).
Loading distributor info...
| Description | Istaroxime hydrochloride is a positive inotropic agent that mediates its action through inhibition of sodium/potassium adenosine triphosphatase (Na+/K+ ATPase). |
|---|
| Catalog Num | A13041 |
|---|---|
| Formula | C21H33ClN2O3 |
| Molecular Weight | 396.95 |
| CAS Number | 374559-48-5 |
| SMILES | O=C1CC[C@@]2([H])[C@]3([H])CC([C@@]4([H])C/C(CC[C@]4(C)[C@@]3([H])CC[C@@]21C)=N/OCCN)=O.[H]Cl |
| Synonyms | PST2744, PST 2744, Istaroxime, Debio 0614, Debio0614 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
