Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PTC596 is an orally active and selective B-cell-specific Moloney murine leukemia virus integration site 1 (BMI-1) inhibitor. |
|---|
| Catalog Num | A19320 |
|---|---|
| Formula | C19H13F5N6 |
| Molecular Weight | 420.34 |
| CAS Number | 1610964-64-1 |
| SMILES | NC1=C(F)C(NC2=CC=C(C(F)(F)F)C=C2)=NC(N3C4=CC(F)=CC=C4N=C3C)=N1 |
| Synonyms | PTC 596, PTC-596 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 78 mg/mL (185.56 mM) | |
| Water | Insoluble | ||
| Ethanol | 7 mg/mL (16.65 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.79 mL | 118.95 mL | 237.9 mL |
| 0.5 mM | 4.76 mL | 23.79 mL | 47.58 mL |
| 1 mM | 2.38 mL | 11.9 mL | 23.79 mL |
| 5 mM | 0.48 mL | 2.38 mL | 4.76 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
