Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Puromycin 2HCl is an aminonucleoside antibiotic, which acts as a protein synthesis inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14268 |
|---|---|
| Formula | C22H29N7O5.2HCl |
| Molecular Weight | 544.43 |
| CAS Number | 58-58-2 |
| SMILES | CN(C)C1=NC=NC2=C1N=CN2[C@H]3[C@@H](C([C@H](O3)CO)NC(=O)[C@H](CC4=CC=C(C=C4)OC)N)O.Cl.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 92 mg/mL (168.98 mM) | |
| Water | Warmed: 92 mg/mL (168.98 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.37 mL | 91.84 mL | 183.68 mL |
| 0.5 mM | 3.67 mL | 18.37 mL | 36.74 mL |
| 1 mM | 1.84 mL | 9.18 mL | 18.37 mL |
| 5 mM | 0.37 mL | 1.84 mL | 3.67 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
