Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pyritinol, also known as pyrithioxine, is a neurotropic agent which reduces permeability of blood-brain barrier to phosphate. It has no vitamin B6 activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17540 |
|---|---|
| Formula | C16H20N2O4S2 |
| Molecular Weight | 368.47 |
| CAS Number | 1098-97-1 |
| SMILES | OCC1=C(CSSCC2=C(CO)C(O)=C(C)N=C2)C=NC(C)=C1O |
| Synonyms | Pyritinol; pyrithioxine; Encephabol; Encefabol; Cerbon 6 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (141.12 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.14 mL | 135.7 mL | 271.39 mL |
| 0.5 mM | 5.43 mL | 27.14 mL | 54.28 mL |
| 1 mM | 2.71 mL | 13.57 mL | 27.14 mL |
| 5 mM | 0.54 mL | 2.71 mL | 5.43 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
