Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | R-IMPP is an anti-secretagogue of PCSK9 (IC50=4.8 μM), which targets the 80S ribosome to inhibit PCSK9 protein translation. |
|---|
| Catalog Num | A20678 |
|---|---|
| Formula | C24H27N3O2 |
| Molecular Weight | 389.49 |
| CAS Number | 2133832-83-2 |
| SMILES | O=C(N(C1=NC=CC2=C1C=CC=C2)[C@H]3CNCCC3)CCC4=CC=C(OC)C=C4 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (174.58 mM) | |
| Water | 6 mg/mL (15.4 mM) | ||
| Ethanol | 68 mg/mL (174.58 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.67 mL | 128.37 mL | 256.75 mL |
| 0.5 mM | 5.13 mL | 25.67 mL | 51.35 mL |
| 1 mM | 2.57 mL | 12.84 mL | 25.67 mL |
| 5 mM | 0.51 mL | 2.57 mL | 5.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
