Loading distributor info...
| Description | Rabeprazole is an inhibitor of H(+)-K(+)-exchanging atpase in gastric parietal cells. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A17437 |
|---|---|
| Formula | C18H21N3O3S |
| Molecular Weight | 359.44 |
| CAS Number | 117976-89-3 |
| SMILES | O=S(C1=NC2=CC=CC=C2N1)CC3=NC=CC(OCCCOC)=C3C |
| Synonyms | Rabeprazole |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 69 mg/mL (191.96 mM) | |
| Water | 69 mg/mL (191.96 mM) | ||
| Ethanol | 69 mg/mL (191.96 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.82 mL | 139.11 mL | 278.21 mL |
| 0.5 mM | 5.56 mL | 27.82 mL | 55.64 mL |
| 1 mM | 2.78 mL | 13.91 mL | 27.82 mL |
| 5 mM | 0.56 mL | 2.78 mL | 5.56 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
