Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | RAF265 (CHIR-265) is an oral, highly selective RAF and VEGFR kinase inhibitor, which is to control or normalize VEGFR-2 along with the inhibition of B-raf and c-Raf mutation to prevent cancers. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10773 |
|---|---|
| Formula | C24H16F6N6O |
| Molecular Weight | 518.4 |
| CAS Number | 927880-90-8 |
| SMILES | CN1C2=C(C=C(C=C2)OC3=CC(=NC=C3)C4=NC=C(N4)C(F)(F)F)N=C1NC5=CC=C(C=C5)C(F)(F)F |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 85 mg/mL (163.96 mM) | |
| Water | Insoluble | ||
| Ethanol | 28 mg/mL (54.01 mM) | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.29 mL | 96.45 mL | 192.9 mL |
| 0.5 mM | 3.86 mL | 19.29 mL | 38.58 mL |
| 1 mM | 1.93 mL | 9.65 mL | 19.29 mL |
| 5 mM | 0.39 mL | 1.93 mL | 3.86 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
