Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ramelteon is a melatonin receptor agonist with both high affinity for melatonin MT1 (IC50 =28.5 ?? 8.55 pM)and MT2 (20.1 ?? 9.25 pM)receptors and selectivity over the MT3 receptor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10777 |
|---|---|
| Formula | C16H21NO2 |
| Molecular Weight | 259.3 |
| CAS Number | 196597-26-9 |
| SMILES | CCC(=O)NCC[C@@H]1CCC2=C1C3=C(C=C2)OCC3 |
| Synonyms | Rozerem, TAK-375, TAK375 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 47 mg/mL (181.22 mM) | |
| Water | Insoluble | ||
| Ethanol | 47 mg/mL (181.22 mM) | ||
| In vivo | 0.5% methylcellulose | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 38.57 mL | 192.83 mL | 385.65 mL |
| 0.5 mM | 7.71 mL | 38.57 mL | 77.13 mL |
| 1 mM | 3.86 mL | 19.28 mL | 38.57 mL |
| 5 mM | 0.77 mL | 3.86 mL | 7.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
