Loading distributor info...
| Description | RCGD423 is a gp130 modulator, which prevents articular cartilage degeneration and promotes repair. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19019 |
|---|---|
| Formula | C15H11BrN2S |
| Molecular Weight | 331.23 |
| CAS Number | 108237-91-8 |
| SMILES | BrC1=CC=C(C=C1)NC2=NC(C3=CC=CC=C3)=CS2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 63 mg/mL (190.19 mM) | |
| Water | Insoluble | ||
| Ethanol | 31 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.19 mL | 150.95 mL | 301.91 mL |
| 0.5 mM | 6.04 mL | 30.19 mL | 60.38 mL |
| 1 mM | 3.02 mL | 15.1 mL | 30.19 mL |
| 5 mM | 0.6 mL | 3.02 mL | 6.04 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
