Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Riociguat (BAY 63-2521; BAY 632521) is a stimulator of soluble guanylate cyclase (sGC). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11549 |
|---|---|
| Formula | C20H19FN8O2 |
| Molecular Weight | 422.42 |
| CAS Number | 625115-55-1 |
| SMILES | CN(C1=C(N=C(N=C1N)C2=NN(C3=C2C=CC=N3)CC4=CC=CC=C4F)N)C(=O)OC |
| Synonyms | BAY 63-2521; BAY 632521 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (179.91 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.67 mL | 118.37 mL | 236.73 mL |
| 0.5 mM | 4.73 mL | 23.67 mL | 47.35 mL |
| 1 mM | 2.37 mL | 11.84 mL | 23.67 mL |
| 5 mM | 0.47 mL | 2.37 mL | 4.73 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
