Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Rivaroxaban is an oxazolidinone derivative optimized for inhibiting both free Factor Xa and Factor Xa bound in the prothrombinase complex. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10800 |
|---|---|
| Formula | C19H18ClN3O5S |
| Molecular Weight | 435.9 |
| CAS Number | 366789-02-8 |
| SMILES | C1COCC(=O)N1C2=CC=C(C=C2)N3C[C@@H](OC3=O)CNC(=O)C4=CC=C(S4)Cl |
| Synonyms | BAY 59-7939, Xarelto |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 83 mg/mL (190.41 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% methylcellulose+0.2% Tween 80 | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.94 mL | 114.71 mL | 229.41 mL |
| 0.5 mM | 4.59 mL | 22.94 mL | 45.88 mL |
| 1 mM | 2.29 mL | 11.47 mL | 22.94 mL |
| 5 mM | 0.46 mL | 2.29 mL | 4.59 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
