Loading distributor info...
| Description | RO-1138452 is a potent and selective IP (prostacyclin) receptor antagonist with high affinity for IP receptors. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17137 |
|---|---|
| Formula | C19H23N3O |
| Molecular Weight | 309.41 |
| CAS Number | 221529-58-4 |
| SMILES | CC(OC1=CC=C(C=C1)CC2=CC=C(NC3=NCCN3)C=C2)C |
| Synonyms | RO1138452, RO 1138452 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (187.45 mM) | |
| Water | Insoluble | ||
| Ethanol | 58 mg/mL (187.45 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.32 mL | 161.6 mL | 323.2 mL |
| 0.5 mM | 6.46 mL | 32.32 mL | 64.64 mL |
| 1 mM | 3.23 mL | 16.16 mL | 32.32 mL |
| 5 mM | 0.65 mL | 3.23 mL | 6.46 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
