Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | RO5126766, also known as CH5126766, is a protein kinase inhibitor specific for the Raf and MEK mitogen-activated protein kinases (MAPKs) with potential anti-neoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14019 |
|---|---|
| Formula | C21H18FN5O5S |
| Molecular Weight | 471.5 |
| CAS Number | 946128-88-7 |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2)OC3=NC=CC=N3)CC4=C(C(=NC=C4)NS(=O)(=O)NC)F |
| Synonyms | RO 5126766, RO-5126766, CH5126766, CH-5126766, CH 5126766. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 93 mg/mL (197.26 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+45% PEG 300+ddH2O | 19 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.21 mL | 106.04 mL | 212.09 mL |
| 0.5 mM | 4.24 mL | 21.21 mL | 42.42 mL |
| 1 mM | 2.12 mL | 10.6 mL | 21.21 mL |
| 5 mM | 0.42 mL | 2.12 mL | 4.24 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
