Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | (S)-Amlodipine is a (S)-Enantiomer of Amlodipine and a dihydropyridine calcium channel blocker with activity resides mainly in the (-)-isomer. |
|---|
| Catalog Num | A14935 |
|---|---|
| Formula | C20H25N2O5Cl |
| Molecular Weight | 408.88 |
| CAS Number | 103129-82-4 |
| SMILES | CCOC(=O)C1=C(NC(=C([C@@H]1C2=CC=CC=C2Cl)C(=O)OC)C)COCCN |
| Synonyms | Levamlodipine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 78 mg/mL (190.76 mM) | |
| Water | 78 mg/mL (190.76 mM) | ||
| Ethanol | 78 mg/mL (190.76 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.46 mL | 122.29 mL | 244.57 mL |
| 0.5 mM | 4.89 mL | 24.46 mL | 48.91 mL |
| 1 mM | 2.45 mL | 12.23 mL | 24.46 mL |
| 5 mM | 0.49 mL | 2.45 mL | 4.89 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
