Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SAR7334 is a potent and specific TRPC6 inhibitor, inhibiting TRPC6 currents with IC50 of 7.9 nM. |
|---|
| Catalog Num | A20836 |
|---|---|
| Formula | C21H22ClN3O |
| Molecular Weight | 367.87 |
| CAS Number | 1333210-07-3 |
| SMILES | N[C@@H](C1)CCCN1[C@@H]2CC3=CC=CC=C3[C@H]2OC4=C(Cl)C=C(C#N)C=C4 |
| Synonyms | SAR 7334, SAR-7334 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (182.12 mM) | |
| Water | Insoluble | ||
| Ethanol | 67 mg/mL (182.12 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.18 mL | 135.92 mL | 271.84 mL |
| 0.5 mM | 5.44 mL | 27.18 mL | 54.37 mL |
| 1 mM | 2.72 mL | 13.59 mL | 27.18 mL |
| 5 mM | 0.54 mL | 2.72 mL | 5.44 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
