Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SB 216763 is a potent and selective cell permeable ATP-competitive inhibitor of GSK3α with an IC50 value of 34 nM (similar potency for GSK3β). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10825 |
|---|---|
| Formula | C19H12Cl2N2O2 |
| Molecular Weight | 371.2 |
| CAS Number | 280744-09-4 |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=C(C(=O)NC3=O)C4=C(C=C(C=C4)Cl)Cl |
| Synonyms | SB-216763, SB216763 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 21 mg/mL (56.56 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+corn oil | 3 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.94 mL | 134.7 mL | 269.4 mL |
| 0.5 mM | 5.39 mL | 26.94 mL | 53.88 mL |
| 1 mM | 2.69 mL | 13.47 mL | 26.94 mL |
| 5 mM | 0.54 mL | 2.69 mL | 5.39 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
