Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SB525334 is a selective inhibitor of transforming growth factor-β receptor I (ALK5, TGF-βRI) (IC50 = 14.3 nM). Inhibits TGF-β1-induced smad2/3 nuclear localization and TGF-βRI-induced mRNA expression in kidney cells | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10827 |
|---|---|
| Formula | C21H21N5 |
| Molecular Weight | 343.4 |
| CAS Number | 356559-20-1 |
| SMILES | CC1=CC=CC(=N1)C2=C(N=C(N2)C(C)(C)C)C3=CC4=NC=CN=C4C=C3 |
| Synonyms | SB-525334, SB525334 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 67 mg/mL (195.09 mM) | |
| Water | Insoluble | ||
| Ethanol | 67 mg/mL (195.09 mM) | ||
| In vivo | 5% DMSO+corn oil | 19 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.12 mL | 145.6 mL | 291.21 mL |
| 0.5 mM | 5.82 mL | 29.12 mL | 58.24 mL |
| 1 mM | 2.91 mL | 14.56 mL | 29.12 mL |
| 5 mM | 0.58 mL | 2.91 mL | 5.82 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
