Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SB-705498 is a potent, selective and orally bioavailable TRPV1 antagonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11143 |
|---|---|
| Formula | C17H16BrF3N4O |
| Molecular Weight | 428 |
| CAS Number | 501951-42-4 |
| SMILES | C1CN(C[C@@H]1NC(=O)NC2=CC=CC=C2Br)C3=NC=C(C=C3)C(F)(F)F |
| Synonyms | SB705498 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 78 mg/mL (181.71 mM) | |
| Water | Insoluble | ||
| Ethanol | 18 mg/mL (41.93 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.36 mL | 116.82 mL | 233.64 mL |
| 0.5 mM | 4.67 mL | 23.36 mL | 46.73 mL |
| 1 mM | 2.34 mL | 11.68 mL | 23.36 mL |
| 5 mM | 0.47 mL | 2.34 mL | 4.67 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
