Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SB-366791 is a novel, potent, and selective, cinnamide TRPV1 antagonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15857 |
|---|---|
| Formula | C16H14ClNO2 |
| Molecular Weight | 287.74 |
| CAS Number | 472981-92-3 |
| SMILES | ClC1=CC=C(/C=C/C(NC2=CC(OC)=CC=C2)=O)C=C1 |
| Synonyms | SB 366791, SB-366791 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (194.61 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.75 mL | 173.77 mL | 347.54 mL |
| 0.5 mM | 6.95 mL | 34.75 mL | 69.51 mL |
| 1 mM | 3.48 mL | 17.38 mL | 34.75 mL |
| 5 mM | 0.7 mL | 3.48 mL | 6.95 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
