Loading distributor info...
| Description | SBI-115 is a TGR5 (GPCR19) antagonist. SBI-115 decreases hepatic cystogenesis with polycystic liver diseases via inhibiting TGR5. |
|---|
| Catalog Num | A17235 |
|---|---|
| Formula | C14H13ClN2O4S |
| Molecular Weight | 340.778 |
| CAS Number | 882366-16-7 |
| SMILES | O=C(C1=NC(S(=O)(CC)=O)=NC=C1Cl)OC2=CC=CC(C)=C2 |
| Synonyms | SBI 115; SBI115; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (170.2 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.34 mL | 146.72 mL | 293.45 mL |
| 0.5 mM | 5.87 mL | 29.34 mL | 58.69 mL |
| 1 mM | 2.93 mL | 14.67 mL | 29.34 mL |
| 5 mM | 0.59 mL | 2.93 mL | 5.87 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
