Loading distributor info...
| Description | SC79 is an AKT activator. SC79 binds to the plecktrin homology (PH) domain of Akt that mimics the binding of PtdIns(3,4,5)P3 to induce a conformational change in Akt that enhances phosphorylation and activation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15541 |
|---|---|
| Formula | C17H17ClN2O5 |
| Molecular Weight | 364.78 |
| CAS Number | 305834-79-1 |
| SMILES | ClC1=CC=C(OC(N)=C(C(OCC)=O)C2C(C#N)C(OCC)=O)C2=C1 |
| Synonyms | SC 79, SC-79 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 61 mg/mL (167.22 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 61 mg/mL (167.22 mM) | ||
| In vivo | 2% DMSO+corn oil | 4 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.41 mL | 137.07 mL | 274.14 mL |
| 0.5 mM | 5.48 mL | 27.41 mL | 54.83 mL |
| 1 mM | 2.74 mL | 13.71 mL | 27.41 mL |
| 5 mM | 0.55 mL | 2.74 mL | 5.48 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
