Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SCR7 pyrazine is an inhibitor of nonhomologous end-joining (NHEJ). |
|---|
| Catalog Num | A17138 |
|---|---|
| Formula | C18H12N4OS |
| Molecular Weight | 332.38 |
| CAS Number | 14892-97-8 |
| SMILES | O=C1NC(NC2=NC(C3=CC=CC=C3)=C(C4=CC=CC=C4)N=C12)=S |
| Synonyms | SCR-7, SCR 7 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 59 mg/mL (177.5 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 3 mg/mL (9.02 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.09 mL | 150.43 mL | 300.86 mL |
| 0.5 mM | 6.02 mL | 30.09 mL | 60.17 mL |
| 1 mM | 3.01 mL | 15.04 mL | 30.09 mL |
| 5 mM | 0.6 mL | 3.01 mL | 6.02 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
