Loading distributor info...
| Description | SEL120-34A is a potent and selective CDK8 inhibitor active in AML cells with high levels of serine phosphorylation of STAT1 and STAT5 transactivation domains. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17086 |
|---|---|
| Formula | C15H18Br2N4 |
| Molecular Weight | 414.145 |
| CAS Number | 1609522-33-9 |
| SMILES | CC1=C2C3=C(C(Br)=C1Br)CCCN3C(N4CCNCC4)=N2 |
| Synonyms | SEL 120-34A, SEL-120-34A, SEL12034A, SEL 12034A, SEL-12034A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 9 mg/mL (19.97 mM) | |
| Water | 77 mg/mL (170.88 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.15 mL | 120.73 mL | 241.46 mL |
| 0.5 mM | 4.83 mL | 24.15 mL | 48.29 mL |
| 1 mM | 2.41 mL | 12.07 mL | 24.15 mL |
| 5 mM | 0.48 mL | 2.41 mL | 4.83 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
