Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SGI 1027 is a DNMT inhibitor with IC50 of 6, 8, 7.5 uM for DNMT1, DNMT3A, and DNMT3B, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14120 |
|---|---|
| Formula | C27H23N7O |
| Molecular Weight | 461.52 |
| CAS Number | 1020149-73-8 |
| SMILES | CC1=CC(=NC(=N1)N)NC2=CC=C(C=C2)NC(=O)C3=CC=C(C=C3)NC4=CC=NC5=CC=CC=C54 |
| Synonyms | SGI-1027, SGI1027 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 85 mg/mL (184.17 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+2% Tween 80+ddH2O | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.67 mL | 108.34 mL | 216.68 mL |
| 0.5 mM | 4.33 mL | 21.67 mL | 43.34 mL |
| 1 mM | 2.17 mL | 10.83 mL | 21.67 mL |
| 5 mM | 0.43 mL | 2.17 mL | 4.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
