Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Silymarin (Silibinin B) inhibits chemically induced urinary bladder tumor growth and progression possibly by inhibiting cell proliferation and enhancing apoptosis. |
|---|
| Catalog Num | A10844 |
|---|---|
| Formula | C25H22O10 |
| Molecular Weight | 482.4 |
| CAS Number | 65666-07-1 |
| SMILES | COC1=C(C=CC(=C1)C2C(OC3=C(O2)C=C(C=C3)C4C(C(=O)C5=C(C=C(C=C5O4)O)O)O)CO)O |
| Synonyms | Silybin B, Silibinin B |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 93 mg/mL (192.76 mM) | |
| Water | Insoluble | ||
| Ethanol | 1 mg/mL (2.07 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.73 mL | 103.65 mL | 207.3 mL |
| 0.5 mM | 4.15 mL | 20.73 mL | 41.46 mL |
| 1 mM | 2.07 mL | 10.36 mL | 20.73 mL |
| 5 mM | 0.41 mL | 2.07 mL | 4.15 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
