Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SJ000291942 is an activator of the canonical bone morphogenetic proteins (BMP) signaling pathway. BMPs are members of the transforming growth factor beta (TGFβ) family of secreted signaling molecules. |
|---|
| Catalog Num | A19460 |
|---|---|
| Formula | C16H15FN2O4 |
| Molecular Weight | 318.3 |
| CAS Number | 425613-09-8 |
| SMILES | O=C(NC1=CC=C(F)C([N+]([O-])=O)=C1)COC2=CC=C(CC)C=C2 |
| Synonyms | SJ 000291942, SJ-000291942 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (188.49 mM) | |
| Water | Insoluble | ||
| Ethanol | 11 mg/mL (34.56 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.42 mL | 157.08 mL | 314.17 mL |
| 0.5 mM | 6.28 mL | 31.42 mL | 62.83 mL |
| 1 mM | 3.14 mL | 15.71 mL | 31.42 mL |
| 5 mM | 0.63 mL | 3.14 mL | 6.28 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
