Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SJB2-043 is one of analogs/derivatives of C527, which is a novel and potent USP1 (ubiquitin-specific protease 1) inhibitor. |
|---|
| Catalog Num | A15238 |
|---|---|
| Formula | C17H9NO3 |
| Molecular Weight | 275.26 |
| CAS Number | 63388-44-3 |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(O2)C(=O)C4=CC=CC=C4C3=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 1 mg/mL (3.63 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.33 mL | 181.65 mL | 363.29 mL |
| 0.5 mM | 7.27 mL | 36.33 mL | 72.66 mL |
| 1 mM | 3.63 mL | 18.16 mL | 36.33 mL |
| 5 mM | 0.73 mL | 3.63 mL | 7.27 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
