Loading distributor info...
| Description | SL-327 is a selective inhibitor of MEK1 and MEK2 (IC50 values are 0.18 and 0.22 μM respectively); blocks hippocampal LTP in vitro. Brain penetrant in vivo, blocking fear conditioning and learning in rats, and producing neuroprotection in mice, following systemic administration. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14137 |
|---|---|
| Formula | C16H12F3N3S |
| Molecular Weight | 335.4 |
| CAS Number | 305350-87-2 |
| SMILES | C1=CC=C(C(=C1)C(=C(N)SC2=CC=C(C=C2)N)C#N)C(F)(F)F |
| Synonyms | SL 327, SL327 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 66 mg/mL (196.81 mM) | |
| Water | Insoluble | ||
| Ethanol | 7 mg/mL (20.87 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 4 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.82 mL | 149.08 mL | 298.15 mL |
| 0.5 mM | 5.96 mL | 29.82 mL | 59.63 mL |
| 1 mM | 2.98 mL | 14.91 mL | 29.82 mL |
| 5 mM | 0.6 mL | 2.98 mL | 5.96 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
