Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SMER28 is a small-molecule enhancer (SMER) of autophagy, inducing autophagy independently of rapamycin in mammalian cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15867 |
|---|---|
| Formula | C11H10BrN3 |
| Molecular Weight | 264.12 |
| CAS Number | 307538-42-7 |
| SMILES | C=CCNC1=C2C=C(Br)C=CC2=NC=N1 |
| Synonyms | SMER 28, SMER-28 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 49 mg/mL (185.52 mM) | |
| Water | Insoluble | ||
| Ethanol | 49 mg/mL (185.52 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+ddH2O | 14 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.86 mL | 189.31 mL | 378.62 mL |
| 0.5 mM | 7.57 mL | 37.86 mL | 75.72 mL |
| 1 mM | 3.79 mL | 18.93 mL | 37.86 mL |
| 5 mM | 0.76 mL | 3.79 mL | 7.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
