Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Sofalcone, a gastric antiulcer agent in clinical use, is known to induce the expression of Heme oxygenase-1 (HO-1) in gastric epithelium. |
|---|
| Catalog Num | A17641 |
|---|---|
| Formula | C27H30O6 |
| Molecular Weight | 450.53 |
| CAS Number | 64506-49-6 |
| SMILES | O=C(O)COC1=CC(OC/C=C(C)/C)=CC=C1C(/C=C/C2=CC=C(OC/C=C(C)/C)C=C2)=O |
| Synonyms | Sofalcone; BRN 2191482; Isoprenyl chalcone; Solon; SU-88; RTECS AJ7126000. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 82 mg/mL (182 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.2 mL | 110.98 mL | 221.96 mL |
| 0.5 mM | 4.44 mL | 22.2 mL | 44.39 mL |
| 1 mM | 2.22 mL | 11.1 mL | 22.2 mL |
| 5 mM | 0.44 mL | 2.22 mL | 4.44 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
