Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Solifenacin-succinate is a muscarinic M3 receptor antagoinst, used in treatment of urinary incontinence. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11215 |
|---|---|
| Formula | C27H32N2O6 |
| Molecular Weight | 480.6 |
| CAS Number | 242478-38-2 |
| SMILES | C1CN2CCC1[C@H](C2)OC(=O)N3CCC4=CC=CC=C4[C@@H]3C5=CC=CC=C5.C(CC(=O)O)C(=O)O |
| Synonyms | YM905, Vesicare |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 3 mg/mL (6.24 mM) | |
| Water | 85 mg/mL (176.88 mM) | ||
| Ethanol | 4 mg/mL (8.32 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.81 mL | 104.04 mL | 208.07 mL |
| 0.5 mM | 4.16 mL | 20.81 mL | 41.61 mL |
| 1 mM | 2.08 mL | 10.4 mL | 20.81 mL |
| 5 mM | 0.42 mL | 2.08 mL | 4.16 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
