Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SRPIN340 is a cell-permeable isonicotinamide that acts as an ATP-competitive SRPK1-selective inhibitor (IC50 = 0.14 and 1.8 μM, respectively, against mSRPK1 and mSRPK2) with much reduced activity against 143 other kinases. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13188 |
|---|---|
| Formula | C18H18F3N3O |
| Molecular Weight | 349.4 |
| CAS Number | 218156-96-8 |
| SMILES | C1CCN(CC1)C2=C(C=C(C=C2)C(F)(F)F)NC(=O)C3=CC=NC=C3 |
| Synonyms | SRPIN 340, SRPIN-340 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 67 mg/mL (191.78 mM) | |
| Water | Insoluble | ||
| Ethanol | 67 mg/mL (191.78 mM) | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 7 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.62 mL | 143.1 mL | 286.2 mL |
| 0.5 mM | 5.72 mL | 28.62 mL | 57.24 mL |
| 1 mM | 2.86 mL | 14.31 mL | 28.62 mL |
| 5 mM | 0.57 mL | 2.86 mL | 5.72 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
