Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SSE15206 is a pyrazolinethioamide derivative that has potent antiproliferative activities in cancer cell lines of different origins and overcomes resistance to microtubule-targeting agents. |
|---|
| Catalog Num | A18350 |
|---|---|
| Formula | C19H21N3O3S |
| Molecular Weight | 371.45 |
| CAS Number | 1370046-40-4 |
| SMILES | S=C(N1N=C(C2=CC=CC=C2)CC1C3=CC(OC)=C(OC)C(OC)=C3)N |
| Synonyms | SSE-15206, SSE 15206 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 63 mg/mL (169.6 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.92 mL | 134.61 mL | 269.22 mL |
| 0.5 mM | 5.38 mL | 26.92 mL | 53.84 mL |
| 1 mM | 2.69 mL | 13.46 mL | 26.92 mL |
| 5 mM | 0.54 mL | 2.69 mL | 5.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
