Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Sulfachlorpyridazine, also known as Sonilyn, Cluricol, Durasulf, and Ba 10370, is an antibacterial agent typically used in agricultural practices. |
|---|
| Catalog Num | A17297 |
|---|---|
| Formula | C10H9ClN4O2S |
| Molecular Weight | 284.71 |
| CAS Number | 80-32-0 |
| SMILES | O=S(C1=CC=C(N)C=C1)(NC2=NN=C(Cl)C=C2)=O |
| Synonyms | Sulfachlorpyridazine; Sonilyn; Cluricol; Durasulf; Ba 10370; Ba-10370; Ba10370 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 53 mg/mL (186.14 mM) | |
| Water | Insoluble | ||
| Ethanol | 8 mg/mL (28.1 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.12 mL | 175.62 mL | 351.23 mL |
| 0.5 mM | 7.02 mL | 35.12 mL | 70.25 mL |
| 1 mM | 3.51 mL | 17.56 mL | 35.12 mL |
| 5 mM | 0.7 mL | 3.51 mL | 7.02 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
