Loading distributor info...
| Description | Tacrine is a derivative of aminoacridine that functions as an inhibitor of both acetylcholinesterase (AChE) and butyrylcholinesterase (IC50s = 31 and 26.5 nM, respectively). |
|---|
| Catalog Num | A17374 |
|---|---|
| Formula | C13H15ClN2 |
| Molecular Weight | 234.73 |
| CAS Number | 1684-40-8 |
| SMILES | NC1=C(CCCC2)C2=NC3=CC=CC=C31.[H]Cl |
| Synonyms | Hydroaminacrine; NSC72108; NSC-72108; NSC72108 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 44 mg/mL (187.45 mM) | |
| Water | 44 mg/mL (187.45 mM) | ||
| Ethanol | 44 mg/mL (187.45 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.6 mL | 213.01 mL | 426.02 mL |
| 0.5 mM | 8.52 mL | 42.6 mL | 85.2 mL |
| 1 mM | 4.26 mL | 21.3 mL | 42.6 mL |
| 5 mM | 0.85 mL | 4.26 mL | 8.52 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
