Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TAS-102 is an orally bioavailable combination agent composed of the cytotoxic pyrimidine analog Trifluridine (5-trifluoro-2??-deoxythymidine or TFT) and a thymidine phosphorylase inhibitor (TPI) tipiracil hydrochloride, in a molar ratio of 1.0:0.5 (TFT:TPI), with potential antineoplastic activity, |
|---|
| Catalog Num | A15533 |
|---|---|
| Formula | C19H23Cl2F3N6O7 |
| Molecular Weight | 575.3 |
| CAS Number | 733030-01-8 |
| SMILES | C1CC(=N)N(C1)CC2=C(C(=O)NC(=O)N2)Cl.C1[C@@H]([C@H](O[C@H]1N2C=C(C(=O)NC2=O)C(F)(F)F)CO)O.Cl |
| Synonyms | TAS102, TAS 102, Lonsurf |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 88 mg/mL (100.97 mM) | |
| Water | Warmed: 13 mg/mL (14.92 mM) | ||
| Ethanol | 88 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.38 mL | 86.91 mL | 173.82 mL |
| 0.5 mM | 3.48 mL | 17.38 mL | 34.76 mL |
| 1 mM | 1.74 mL | 8.69 mL | 17.38 mL |
| 5 mM | 0.35 mL | 1.74 mL | 3.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
