Loading distributor info...
| Description | TCS JNK 6o is a ATP-competitive and selective c-Jun N-terminal kinase (JNK) inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16054 |
|---|---|
| Formula | C18H20N4O4 |
| Molecular Weight | 356.38 |
| CAS Number | 894804-07-0 |
| SMILES | O=C(CC1=CC(OC)=CC=C1OC)NC2=NC(OCC)=C(C#N)C(N)=C2 |
| Synonyms | JNK Inhibitor VIII |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (188 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.06 mL | 140.3 mL | 280.6 mL |
| 0.5 mM | 5.61 mL | 28.06 mL | 56.12 mL |
| 1 mM | 2.81 mL | 14.03 mL | 28.06 mL |
| 5 mM | 0.56 mL | 2.81 mL | 5.61 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
