Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Tenalisib, also known as RP6530, is a potent and selective dual PI3Kδ/γ inhibitor that inhibited growth of B-cell lymphoma cell lines with a concomitant reduction in the downstream biomarker, pAKT. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16799 |
|---|---|
| Formula | C23H18FN5O2 |
| Molecular Weight | 415.43 |
| CAS Number | 1639417-53-0 |
| SMILES | O=C1C(C2=CC=CC(F)=C2)=C([C@@H](NC3=C4NC=NC4=NC=N3)CC)OC5=C1C=CC=C5 |
| Synonyms | RP-6530, RP 6530 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 74 mg/mL (178.13 mM) | |
| Water | Insoluble | ||
| Ethanol | 74 mg/mL (178.13 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.07 mL | 120.36 mL | 240.71 mL |
| 0.5 mM | 4.81 mL | 24.07 mL | 48.14 mL |
| 1 mM | 2.41 mL | 12.04 mL | 24.07 mL |
| 5 mM | 0.48 mL | 2.41 mL | 4.81 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
