Signaling Pathway
TG101209, a novel JAK2 inhibitor, has significant in vitro activity in multiple myeloma and displays preferential cytotoxicity for CD45+ myeloma cells.
Important Notice: For research use only. We do not sell to patients.
| Discription | TG101209, a novel JAK2 inhibitor, has significant in vitro activity in multiple myeloma and displays preferential cytotoxicity for CD45+ myeloma cells. |
||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11180 |
|---|---|
| Formula | C26H35N7O2S |
| Molecular Weight | 509.67 |
| CAS Number | 936091-14-4 |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)NC3N=C(NC4=CC(=CC=C4)S(=O)(=O)NC(C)(C)C)C(C)=CN=3 |
| Synonyms | TG-101209 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 94 mg/mL (184.42 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 11 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.62 mL | 98.1 mL | 196.21 mL |
| 0.5 mM | 3.92 mL | 19.62 mL | 39.24 mL |
| 1 mM | 1.96 mL | 9.81 mL | 19.62 mL |
| 5 mM | 0.39 mL | 1.96 mL | 3.92 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
