Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TG4-155 is a potent, brain-permeant and selective EP2 receptor antagonist with a Ki of 9.9 nM. |
|---|
| Catalog Num | A20758 |
|---|---|
| Formula | C23H26N2O4 |
| Molecular Weight | 394.46 |
| CAS Number | 1164462-05-8 |
| SMILES | O=C(NCCN1C(C)=CC2=C1C=CC=C2)/C=C/C3=CC(OC)=C(OC)C(OC)=C3 |
| Synonyms | TG4155, TG4 155 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (195.2 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (12.67 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.35 mL | 126.76 mL | 253.51 mL |
| 0.5 mM | 5.07 mL | 25.35 mL | 50.7 mL |
| 1 mM | 2.54 mL | 12.68 mL | 25.35 mL |
| 5 mM | 0.51 mL | 2.54 mL | 5.07 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
