Loading distributor info...
| Description | TH-302 is a selectively targeting hypoxic regions of solid tumors hypoxia-activated prodrug. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A11144 |
|---|---|
| Formula | C9H16Br2N5O4P |
| Molecular Weight | 449 |
| CAS Number | 918633-87-1 |
| SMILES | CN1C(=CN=C1[N+](=O)[O-])COP(=O)(NCCBr)NCCBr |
| Synonyms | TH302 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 80 mg/mL (178.15 mM) | |
| Water | Warmed: 9 mg/mL (20.03 mM) | ||
| Ethanol | 80 mg/mL (178.15 mM) | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.27 mL | 111.36 mL | 222.72 mL |
| 0.5 mM | 4.45 mL | 22.27 mL | 44.54 mL |
| 1 mM | 2.23 mL | 11.14 mL | 22.27 mL |
| 5 mM | 0.45 mL | 2.23 mL | 4.45 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
