Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | THAL-SNS-032 is a selective CDK9 degrader PROTAC consisting of a CDK-binding SNS-032 ligand linked to a thalidomide derivative that binds the E3 ubiquitin ligase Cereblon (CRBN). | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A19088 |
|---|---|
| Formula | C40H52N8O10S2 |
| Molecular Weight | 869.02 |
| CAS Number | 2139287-33-3 |
| SMILES | O=C(NCCOCCOCCOCCNC1=CC=CC(C(N2C(CC3)C(NC3=O)=O)=O)=C1C2=O)CN4CCC(C(NC5=NC=C(SCC6=NC=C(C(C)(C)C)O6)S5)=O)CC4 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (102.41 mM) | |
| Water | Insoluble | ||
| Ethanol | 27 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 11.51 mL | 57.54 mL | 115.07 mL |
| 0.5 mM | 2.3 mL | 11.51 mL | 23.01 mL |
| 1 mM | 1.15 mL | 5.75 mL | 11.51 mL |
| 5 mM | 0.23 mL | 1.15 mL | 2.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
