Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Thiazovivin is a selective inhibitor of Rho-associated kinase (ROCK). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10928 |
|---|---|
| Formula | C15H13N5OS |
| Molecular Weight | 311.4 |
| CAS Number | 1226056-71-8 |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CSC(=N2)NC3=NC=NC=C3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 15 mg/mL (48.17 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.11 mL | 160.57 mL | 321.13 mL |
| 0.5 mM | 6.42 mL | 32.11 mL | 64.23 mL |
| 1 mM | 3.21 mL | 16.06 mL | 32.11 mL |
| 5 mM | 0.64 mL | 3.21 mL | 6.42 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
