Thymidine is a nucleoside in which THYMINE is linked to DEOXYRIBOSE. Thymidine is a DNA synthesis inhibitor that can arrest cell at G1/S boundary, prior to DNA replication.
Loading distributor info...
| Description | Thymidine is a nucleoside in which THYMINE is linked to DEOXYRIBOSE. Thymidine is a DNA synthesis inhibitor that can arrest cell at G1/S boundary, prior to DNA replication. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A17423 |
|---|---|
| Formula | C10H14N2O5 |
| Molecular Weight | 242.23 |
| CAS Number | 50-89-5 |
| SMILES | OC[C@@H]1[C@H](C[C@H](N2C(NC(C(C)=C2)=O)=O)O1)O |
| Synonyms | Thymidine; AI3-52267; AI3 52267; AI352267 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 43 mg/mL (177.51 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.28 mL | 206.42 mL | 412.83 mL |
| 0.5 mM | 8.26 mL | 41.28 mL | 82.57 mL |
| 1 mM | 4.13 mL | 20.64 mL | 41.28 mL |
| 5 mM | 0.83 mL | 4.13 mL | 8.26 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
