Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Tilorone Dihydrochloride is an antiviral, antineoplastic, and anti-inflammatory agent; Orally active interferon inducer, inhibiting Ebola virus (EBOV). | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A17487 |
|---|---|
| Formula | C25H36Cl2N2O3 |
| Molecular Weight | 483.47 |
| CAS Number | 27591-69-1 |
| SMILES | O=C1C2=C(C3=C1C=C(OCCN(CC)CC)C=C3)C=CC(OCCN(CC)CC)=C2.[H]Cl.[H]Cl |
| Synonyms | Tilorone Dihydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 38 mg/mL (78.6 mM) | |
| Water | 84 mg/mL (173.74 mM) | ||
| Ethanol | 84 mg/mL (173.74 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.68 mL | 103.42 mL | 206.84 mL |
| 0.5 mM | 4.14 mL | 20.68 mL | 41.37 mL |
| 1 mM | 2.07 mL | 10.34 mL | 20.68 mL |
| 5 mM | 0.41 mL | 2.07 mL | 4.14 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
