Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tiplaxtinin is a selective and orally efficacious inhibitor of plasminogen activator inhibitor-1 (PAI-1) with IC50 of 2.7 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14190 |
|---|---|
| Formula | C24H16F3NO4 |
| Molecular Weight | 439.3833 |
| CAS Number | 393105-53-8 |
| SMILES | C1=CC=C(C=C1)CN2C=C(C3=C2C=CC(=C3)C4=CC=C(C=C4)OC(F)(F)F)C(=O)C(=O)O |
| Synonyms | PAI-039 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 62 mg/mL (141.1 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 15 mg/mL (34.13 mM) | ||
| In vivo | 2.0% Tween 80+0.5% methylcellulose | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.76 mL | 113.8 mL | 227.59 mL |
| 0.5 mM | 4.55 mL | 22.76 mL | 45.52 mL |
| 1 mM | 2.28 mL | 11.38 mL | 22.76 mL |
| 5 mM | 0.46 mL | 2.28 mL | 4.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
